C13H19NO2 — CID 115171380
[2-(2,4-dimethylphenyl)-2-methylpropyl]carbamic acid (PubChem CID 115171380) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-methylpropyl]carbamic acid.
| Compound Name | [2-(2,4-dimethylphenyl)-2-methylpropyl]carbamic acid |
|---|---|
| PubChem CID | 115171380 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-methylpropyl]carbamic acid |
| SMILES | Cc1ccc(C(C)(C)CNC(=O)O)c(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-9-5-6-11(10(2)7-9)13(3,4)8-14-12(15)16/h5-7,14H,8H2,1-4H3,(H,15,16) |
| InChIKey | LYZKZOMDGLOITP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |