C16H22N2O — CID 115174062
3-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]propanamide (PubChem CID 115174062) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]propanamide.
| Compound Name | 3-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]propanamide |
|---|---|
| PubChem CID | 115174062 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]propanamide |
| SMILES | Cc1ccc(C(C)(C)CNC(=O)CCC#N)c(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-7-8-14(13(2)10-12)16(3,4)11-18-15(19)6-5-9-17/h7-8,10H,5-6,11H2,1-4H3,(H,18,19) |
| InChIKey | WGUCOTQJQBHTOX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |