C15H20N2O — CID 115173418
2-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide (PubChem CID 115173418) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide.
| Compound Name | 2-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 115173418 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-cyano-N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide |
| SMILES | Cc1ccc(C(C)(C)CNC(=O)CC#N)c(C)c1 |
| InChI | InChI=1S/C15H20N2O/c1-11-5-6-13(12(2)9-11)15(3,4)10-17-14(18)7-8-16/h5-6,9H,7,10H2,1-4H3,(H,17,18) |
| InChIKey | GMWXHRNMVZDKKZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |