C14H21NO — CID 115191406
N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide (PubChem CID 115191406) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 115191406 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)-2-methylpropyl]acetamide |
| SMILES | CC(=O)NCC(C)(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H21NO/c1-10-6-7-13(11(2)8-10)14(4,5)9-15-12(3)16/h6-8H,9H2,1-5H3,(H,15,16) |
| InChIKey | KNIYRDGGWKCSRZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |