C23H24O — CID 54297310
(2,4-dimethylphenyl)-bis(4-methylphenyl)methanol (PubChem CID 54297310) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-bis(4-methylphenyl)methanol.
| Compound Name | (2,4-dimethylphenyl)-bis(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 54297310 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2,4-dimethylphenyl)-bis(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H24O/c1-16-5-10-20(11-6-16)23(24,21-12-7-17(2)8-13-21)22-14-9-18(3)15-19(22)4/h5-15,24H,1-4H3 |
| InChIKey | SBRMUQKXERNINF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|