C19H25NO — CID 62774556
1-(2,4-dimethylphenyl)-1-phenyl-2-(propan-2-ylamino)ethanol (PubChem CID 62774556) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1-phenyl-2-(propan-2-ylamino)ethanol.
| Compound Name | 1-(2,4-dimethylphenyl)-1-phenyl-2-(propan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 62774556 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1-phenyl-2-(propan-2-ylamino)ethanol |
| SMILES | Cc1ccc(C(O)(CNC(C)C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H25NO/c1-14(2)20-13-19(21,17-8-6-5-7-9-17)18-11-10-15(3)12-16(18)4/h5-12,14,20-21H,13H2,1-4H3 |
| InChIKey | UZOXERFYFQNWAH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |