About 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride
1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride (PubChem CID 131741515) has the molecular formula C22H24ClN
and a molecular weight of 337.89 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride |
| PubChem CID | 131741515 |
| Molecular Formula | C22H24ClN |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride |
| SMILES | Cc1ccc(C(N)(Cc2ccccc2)c2ccccc2)c(C)c1.Cl |
| InChI | InChI=1S/C22H23N.ClH/c1-17-13-14-21(18(2)15-17)22(23,20-11-7-4-8-12-20)16-19-9-5-3-6-10-19;/h3-15H,16,23H2,1-2H3;1H |
| InChIKey | GFJFTMPEPJCPBS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride?
The IUPAC name of 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride (CID 131741515) is 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride?
The canonical SMILES for 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride is Cc1ccc(C(N)(Cc2ccccc2)c2ccccc2)c(C)c1.Cl.
What is the InChIKey of 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride?
The InChIKey is GFJFTMPEPJCPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N.ClH/c1-17-13-14-21(18(2)15-17)22(23,20-11-7-4-8-12-20)16-19-9-5-3-6-10-19;/h3-15H,16,23H2,1-2H3;1H.
What are the key properties of 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride?
1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride has a molecular weight of 337.89 g/mol, XLogP of 5.17, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-1,2-diphenylethanamine;hydrochloride is sourced from PubChem (CID 131741515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).