About 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene
1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene (PubChem CID 116841375) has the molecular formula C12H16F2
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene.
Analyze 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene?
The IUPAC name of 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene (CID 116841375) is 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene.
What is the SMILES notation for 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene?
The canonical SMILES for 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene is Cc1ccc(C(F)(F)C(C)C)c(C)c1.
What is the InChIKey of 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene?
The InChIKey is VQPCTBMWOXVVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2/c1-8(2)12(13,14)11-6-5-9(3)7-10(11)4/h5-8H,1-4H3.
What are the key properties of 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene?
1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene has a molecular weight of 198.26 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoro-2-methylpropyl)-2,4-dimethylbenzene is sourced from PubChem (CID 116841375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).