C11H15F3S — CID 143231440
2,4-dimethyl-1-(trifluoromethylsulfanyl)benzene;ethane (PubChem CID 143231440) has the molecular formula C11H15F3S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2,4-dimethyl-1-(trifluoromethylsulfanyl)benzene;ethane.
| Compound Name | 2,4-dimethyl-1-(trifluoromethylsulfanyl)benzene;ethane |
|---|---|
| PubChem CID | 143231440 |
| Molecular Formula | C11H15F3S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2,4-dimethyl-1-(trifluoromethylsulfanyl)benzene;ethane |
| SMILES | CC.Cc1ccc(SC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C9H9F3S.C2H6/c1-6-3-4-8(7(2)5-6)13-9(10,11)12;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | YPFDPQKBYSGETH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |