About 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene
1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene (PubChem CID 118824763) has the molecular formula C9H8F4S
and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene.
Molecular Properties
| Compound Name | 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene |
| PubChem CID | 118824763 |
| Molecular Formula | C9H8F4S |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene |
| SMILES | Cc1c(F)ccc(SC(F)(F)F)c1C |
| InChI | InChI=1S/C9H8F4S/c1-5-6(2)8(4-3-7(5)10)14-9(11,12)13/h3-4H,1-2H3 |
| InChIKey | WWDZWOGCCWIFDX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene?
The IUPAC name of 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene (CID 118824763) is 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene.
What is the SMILES notation for 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene?
The canonical SMILES for 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene is Cc1c(F)ccc(SC(F)(F)F)c1C.
What is the InChIKey of 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene?
The InChIKey is WWDZWOGCCWIFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F4S/c1-5-6(2)8(4-3-7(5)10)14-9(11,12)13/h3-4H,1-2H3.
What are the key properties of 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene?
1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene has a molecular weight of 224.22 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)benzene is sourced from PubChem (CID 118824763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).