C9H9F4NS — CID 59638647
6-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)aniline (PubChem CID 59638647) has the molecular formula C9H9F4NS and a molecular weight of 239.24 g/mol. Its IUPAC name is 6-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)aniline.
| Compound Name | 6-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 59638647 |
| Molecular Formula | C9H9F4NS |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 6-fluoro-2,3-dimethyl-4-(trifluoromethylsulfanyl)aniline |
| SMILES | Cc1c(SC(F)(F)F)cc(F)c(N)c1C |
| InChI | InChI=1S/C9H9F4NS/c1-4-5(2)8(14)6(10)3-7(4)15-9(11,12)13/h3H,14H2,1-2H3 |
| InChIKey | ILZCXNROCSNTML-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|