methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate

C12H15FO2 — CID 105464025

IUPACmethyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate
SMILESCOC(=O)C(C)(F)c1ccc(C)cc1C
InChIInChI=1S/C12H15FO2/c1-8-5-6-10(9(2)7-8)12(3,13)11(14)15-4/h5-7H,1-4H3
InChIKeyOYTSPVFKKPBMGK-UHFFFAOYSA-N
MW210.25 g/mol
LogP2.66
Rot. Bonds2

About methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate

methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate (PubChem CID 105464025) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate.

Molecular Properties

Compound Namemethyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate
PubChem CID105464025
Molecular FormulaC12H15FO2
Molecular Weight210.25 g/mol
Exact Mass210.11
IUPAC Namemethyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate
SMILESCOC(=O)C(C)(F)c1ccc(C)cc1C
InChIInChI=1S/C12H15FO2/c1-8-5-6-10(9(2)7-8)12(3,13)11(14)15-4/h5-7H,1-4H3
InChIKeyOYTSPVFKKPBMGK-UHFFFAOYSA-N
XLogP2.66
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.25
LogP ≤ 52.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate?
The IUPAC name of methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate (CID 105464025) is methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate.
What is the SMILES notation for methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate?
The canonical SMILES for methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate is COC(=O)C(C)(F)c1ccc(C)cc1C.
What is the InChIKey of methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate?
The InChIKey is OYTSPVFKKPBMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO2/c1-8-5-6-10(9(2)7-8)12(3,13)11(14)15-4/h5-7H,1-4H3.
What are the key properties of methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate?
methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate has a molecular weight of 210.25 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dimethylphenyl)-2-fluoropropanoate is sourced from PubChem (CID 105464025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).