C12H15N — CID 149234798
1-(2-isocyanopropan-2-yl)-2,4-dimethylbenzene (PubChem CID 149234798) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-(2-isocyanopropan-2-yl)-2,4-dimethylbenzene.
| Compound Name | 1-(2-isocyanopropan-2-yl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 149234798 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-(2-isocyanopropan-2-yl)-2,4-dimethylbenzene |
| SMILES | [C-]#[N+]C(C)(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H15N/c1-9-6-7-11(10(2)8-9)12(3,4)13-5/h6-8H,1-4H3 |
| InChIKey | XKZVPLZEQOUPSE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|