About (3R)-3-acetyl-5,5-dimethylhexanamide
(3R)-3-acetyl-5,5-dimethylhexanamide (PubChem CID 142089595) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (3R)-3-acetyl-5,5-dimethylhexanamide.
Molecular Properties
| Compound Name | (3R)-3-acetyl-5,5-dimethylhexanamide |
| PubChem CID | 142089595 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3R)-3-acetyl-5,5-dimethylhexanamide |
| SMILES | CC(=O)[C@@H](CC(N)=O)CC(C)(C)C |
| InChI | InChI=1S/C10H19NO2/c1-7(12)8(5-9(11)13)6-10(2,3)4/h8H,5-6H2,1-4H3,(H2,11,13)/t8-/m0/s1 |
| InChIKey | OZILQZNPOGNYGC-QMMMGPOBSA-N |
| XLogP | 1.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-acetyl-5,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-acetyl-5,5-dimethylhexanamide?
The IUPAC name of (3R)-3-acetyl-5,5-dimethylhexanamide (CID 142089595) is (3R)-3-acetyl-5,5-dimethylhexanamide.
What is the SMILES notation for (3R)-3-acetyl-5,5-dimethylhexanamide?
The canonical SMILES for (3R)-3-acetyl-5,5-dimethylhexanamide is CC(=O)[C@@H](CC(N)=O)CC(C)(C)C.
What is the InChIKey of (3R)-3-acetyl-5,5-dimethylhexanamide?
The InChIKey is OZILQZNPOGNYGC-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19NO2/c1-7(12)8(5-9(11)13)6-10(2,3)4/h8H,5-6H2,1-4H3,(H2,11,13)/t8-/m0/s1.
What are the key properties of (3R)-3-acetyl-5,5-dimethylhexanamide?
(3R)-3-acetyl-5,5-dimethylhexanamide has a molecular weight of 185.27 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-acetyl-5,5-dimethylhexanamide is sourced from PubChem (CID 142089595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).