C14H29N — CID 170179650
N-tert-butyl-N,5,5-trimethyl-4-methylidenehexan-3-amine (PubChem CID 170179650) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is N-tert-butyl-N,5,5-trimethyl-4-methylidenehexan-3-amine.
| Compound Name | N-tert-butyl-N,5,5-trimethyl-4-methylidenehexan-3-amine |
|---|---|
| PubChem CID | 170179650 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N-tert-butyl-N,5,5-trimethyl-4-methylidenehexan-3-amine |
| SMILES | C=C(C(CC)N(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H29N/c1-10-12(11(2)13(3,4)5)15(9)14(6,7)8/h12H,2,10H2,1,3-9H3 |
| InChIKey | OTFDQSVIIHTDDC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|