C13H25N — CID 155468081
N-but-1-en-2-yl-5,5-dimethyl-4-methylidenehexan-3-amine (PubChem CID 155468081) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N-but-1-en-2-yl-5,5-dimethyl-4-methylidenehexan-3-amine.
| Compound Name | N-but-1-en-2-yl-5,5-dimethyl-4-methylidenehexan-3-amine |
|---|---|
| PubChem CID | 155468081 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-but-1-en-2-yl-5,5-dimethyl-4-methylidenehexan-3-amine |
| SMILES | C=C(CC)NC(CC)C(=C)C(C)(C)C |
| InChI | InChI=1S/C13H25N/c1-8-10(3)14-12(9-2)11(4)13(5,6)7/h12,14H,3-4,8-9H2,1-2,5-7H3 |
| InChIKey | IEMOPFKTFIKGLU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|