C15H29NO — CID 166719655
4-(3,3,5-trimethylhex-1-en-2-ylamino)hexan-3-one (PubChem CID 166719655) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 4-(3,3,5-trimethylhex-1-en-2-ylamino)hexan-3-one.
| Compound Name | 4-(3,3,5-trimethylhex-1-en-2-ylamino)hexan-3-one |
|---|---|
| PubChem CID | 166719655 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 4-(3,3,5-trimethylhex-1-en-2-ylamino)hexan-3-one |
| SMILES | C=C(NC(CC)C(=O)CC)C(C)(C)CC(C)C |
| InChI | InChI=1S/C15H29NO/c1-8-13(14(17)9-2)16-12(5)15(6,7)10-11(3)4/h11,13,16H,5,8-10H2,1-4,6-7H3 |
| InChIKey | VHTFRCVQZPBEMN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |