C12H26N2O — CID 142227704
6,6,7-trimethyl-4-(2-methylhydrazinyl)octan-3-one (PubChem CID 142227704) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 6,6,7-trimethyl-4-(2-methylhydrazinyl)octan-3-one.
| Compound Name | 6,6,7-trimethyl-4-(2-methylhydrazinyl)octan-3-one |
|---|---|
| PubChem CID | 142227704 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 6,6,7-trimethyl-4-(2-methylhydrazinyl)octan-3-one |
| SMILES | CCC(=O)C(CC(C)(C)C(C)C)NNC |
| InChI | InChI=1S/C12H26N2O/c1-7-11(15)10(14-13-6)8-12(4,5)9(2)3/h9-10,13-14H,7-8H2,1-6H3 |
| InChIKey | ZCPKGEHIMDDSNE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|