C14H26O3 — CID 91028828
(3-methyloxiran-2-yl)methyl 2,4,4,5-tetramethylhexanoate (PubChem CID 91028828) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (3-methyloxiran-2-yl)methyl 2,4,4,5-tetramethylhexanoate.
| Compound Name | (3-methyloxiran-2-yl)methyl 2,4,4,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 91028828 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (3-methyloxiran-2-yl)methyl 2,4,4,5-tetramethylhexanoate |
| SMILES | CC(CC(C)(C)C(C)C)C(=O)OCC1OC1C |
| InChI | InChI=1S/C14H26O3/c1-9(2)14(5,6)7-10(3)13(15)16-8-12-11(4)17-12/h9-12H,7-8H2,1-6H3 |
| InChIKey | MWURMABJPRKDSF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|