C17H30O3 — CID 123340640
(5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-3-yl)methyl 2,4,4-trimethylpentanoate (PubChem CID 123340640) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-3-yl)methyl 2,4,4-trimethylpentanoate.
| Compound Name | (5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-3-yl)methyl 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123340640 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-3-yl)methyl 2,4,4-trimethylpentanoate |
| SMILES | CC1CC2COC(COC(=O)C(C)CC(C)(C)C)C2C1 |
| InChI | InChI=1S/C17H30O3/c1-11-6-13-9-19-15(14(13)7-11)10-20-16(18)12(2)8-17(3,4)5/h11-15H,6-10H2,1-5H3 |
| InChIKey | JIBCRSRPZVOZKG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |