C24H48O6 — CID 157170862
2-hydroxypropyl 3,5,5-trimethylhexanoate;2-methyloxirane;3,5,5-trimethylhexanoic acid (PubChem CID 157170862) has the molecular formula C24H48O6 and a molecular weight of 432.64 g/mol. Its IUPAC name is 2-hydroxypropyl 3,5,5-trimethylhexanoate;2-methyloxirane;3,5,5-trimethylhexanoic acid.
| Compound Name | 2-hydroxypropyl 3,5,5-trimethylhexanoate;2-methyloxirane;3,5,5-trimethylhexanoic acid |
|---|---|
| PubChem CID | 157170862 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 2-hydroxypropyl 3,5,5-trimethylhexanoate;2-methyloxirane;3,5,5-trimethylhexanoic acid |
| SMILES | CC(CC(=O)O)CC(C)(C)C.CC(O)COC(=O)CC(C)CC(C)(C)C.CC1CO1 |
| InChI | InChI=1S/C12H24O3.C9H18O2.C3H6O/c1-9(7-12(3,4)5)6-11(14)15-8-10(2)13;1-7(5-8(10)11)6-9(2,3)4;1-3-2-4-3/h9-10,13H,6-8H2,1-5H3;7H,5-6H2,1-4H3,(H,10,11);3H,2H2,1H3 |
| InChIKey | ANLHAUFEBFARGG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|