C9H21N3O4 — CID 161102604
(3S)-4-amino-3-hydroxybutanamide;(3R)-3-hydroxypentanamide (PubChem CID 161102604) has the molecular formula C9H21N3O4 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3S)-4-amino-3-hydroxybutanamide;(3R)-3-hydroxypentanamide.
| Compound Name | (3S)-4-amino-3-hydroxybutanamide;(3R)-3-hydroxypentanamide |
|---|---|
| PubChem CID | 161102604 |
| Molecular Formula | C9H21N3O4 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | (3S)-4-amino-3-hydroxybutanamide;(3R)-3-hydroxypentanamide |
| SMILES | CC[C@@H](O)CC(N)=O.NC[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C5H11NO2.C4H10N2O2/c1-2-4(7)3-5(6)8;5-2-3(7)1-4(6)8/h4,7H,2-3H2,1H3,(H2,6,8);3,7H,1-2,5H2,(H2,6,8)/t4-;3-/m10/s1 |
| InChIKey | UIQANFRQPHYBMI-FOJGEQFDSA-N |
| XLogP | -2.19 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |