C12H25NO4 — CID 89227447
(3R,5S)-3,5,6-trihydroxy-N,N-di(propan-2-yl)hexanamide (PubChem CID 89227447) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is (3R,5S)-3,5,6-trihydroxy-N,N-di(propan-2-yl)hexanamide.
| Compound Name | (3R,5S)-3,5,6-trihydroxy-N,N-di(propan-2-yl)hexanamide |
|---|---|
| PubChem CID | 89227447 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (3R,5S)-3,5,6-trihydroxy-N,N-di(propan-2-yl)hexanamide |
| SMILES | CC(C)N(C(=O)C[C@H](O)C[C@H](O)CO)C(C)C |
| InChI | InChI=1S/C12H25NO4/c1-8(2)13(9(3)4)12(17)6-10(15)5-11(16)7-14/h8-11,14-16H,5-7H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | ZMZBWZIABDIFAY-MNOVXSKESA-N |
| XLogP | 0.13 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |