C6H11O5- — CID 22623307
3,5,6-trihydroxyhexanoate (PubChem CID 22623307) has the molecular formula C6H11O5- and a molecular weight of 163.15 g/mol. Its IUPAC name is 3,5,6-trihydroxyhexanoate.
| Compound Name | 3,5,6-trihydroxyhexanoate |
|---|---|
| PubChem CID | 22623307 |
| Molecular Formula | C6H11O5- |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3,5,6-trihydroxyhexanoate |
| SMILES | O=C([O-])CC(O)CC(O)CO |
| InChI | InChI=1S/C6H12O5/c7-3-5(9)1-4(8)2-6(10)11/h4-5,7-9H,1-3H2,(H,10,11)/p-1 |
| InChIKey | IBMKUBQFLWTZDC-UHFFFAOYSA-M |
| XLogP | -2.77 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |