C12H22ClNO3 — CID 86639762
6-chloro-5-hydroxy-3-oxo-N,N-di(propan-2-yl)hexanamide (PubChem CID 86639762) has the molecular formula C12H22ClNO3 and a molecular weight of 263.76 g/mol. Its IUPAC name is 6-chloro-5-hydroxy-3-oxo-N,N-di(propan-2-yl)hexanamide.
| Compound Name | 6-chloro-5-hydroxy-3-oxo-N,N-di(propan-2-yl)hexanamide |
|---|---|
| PubChem CID | 86639762 |
| Molecular Formula | C12H22ClNO3 |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-chloro-5-hydroxy-3-oxo-N,N-di(propan-2-yl)hexanamide |
| SMILES | CC(C)N(C(=O)CC(=O)CC(O)CCl)C(C)C |
| InChI | InChI=1S/C12H22ClNO3/c1-8(2)14(9(3)4)12(17)6-10(15)5-11(16)7-13/h8-9,11,16H,5-7H2,1-4H3 |
| InChIKey | DGXXOJQNHRVDEE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|