About ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen
ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen (PubChem CID 158831463) has the molecular formula C12H22Cl2O6
and a molecular weight of 333.21 g/mol. Its IUPAC name is ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen |
| PubChem CID | 158831463 |
| Molecular Formula | C12H22Cl2O6 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen |
| SMILES | CCOC(=O)CC(=O)CCl.CCOC(=O)CC(O)CCl.[H][H] |
| InChI | InChI=1S/C6H11ClO3.C6H9ClO3.H2/c2*1-2-10-6(9)3-5(8)4-7;/h5,8H,2-4H2,1H3;2-4H2,1H3;1H |
| InChIKey | IXCDANGIGMSAIT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen?
The IUPAC name of ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen (CID 158831463) is ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen.
What is the SMILES notation for ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen?
The canonical SMILES for ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen is CCOC(=O)CC(=O)CCl.CCOC(=O)CC(O)CCl.[H][H].
What is the InChIKey of ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen?
The InChIKey is IXCDANGIGMSAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO3.C6H9ClO3.H2/c2*1-2-10-6(9)3-5(8)4-7;/h5,8H,2-4H2,1H3;2-4H2,1H3;1H.
What are the key properties of ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen?
ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen has a molecular weight of 333.21 g/mol, XLogP of 1.53, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-3-hydroxybutanoate;ethyl 4-chloro-3-oxobutanoate;molecular hydrogen is sourced from PubChem (CID 158831463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).