C8H13NO5 — CID 58922019
2-amino-6-ethoxy-4,6-dioxohexanoic acid (PubChem CID 58922019) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-amino-6-ethoxy-4,6-dioxohexanoic acid.
| Compound Name | 2-amino-6-ethoxy-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 58922019 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-amino-6-ethoxy-4,6-dioxohexanoic acid |
| SMILES | CCOC(=O)CC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C8H13NO5/c1-2-14-7(11)4-5(10)3-6(9)8(12)13/h6H,2-4,9H2,1H3,(H,12,13) |
| InChIKey | WZHZUMPALRCJGB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|