About ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid
ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid (PubChem CID 172837114) has the molecular formula C7H13ClO6S
and a molecular weight of 260.69 g/mol. Its IUPAC name is ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid.
Molecular Properties
| Compound Name | ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid |
| PubChem CID | 172837114 |
| Molecular Formula | C7H13ClO6S |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid |
| SMILES | CCOC(=O)CC(=O)CCl.CS(=O)(=O)O |
| InChI | InChI=1S/C6H9ClO3.CH4O3S/c1-2-10-6(9)3-5(8)4-7;1-5(2,3)4/h2-4H2,1H3;1H3,(H,2,3,4) |
| InChIKey | WHIAFUJKWPACNV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid?
The IUPAC name of ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid (CID 172837114) is ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid.
What is the SMILES notation for ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid?
The canonical SMILES for ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid is CCOC(=O)CC(=O)CCl.CS(=O)(=O)O.
What is the InChIKey of ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid?
The InChIKey is WHIAFUJKWPACNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO3.CH4O3S/c1-2-10-6(9)3-5(8)4-7;1-5(2,3)4/h2-4H2,1H3;1H3,(H,2,3,4).
What are the key properties of ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid?
ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid has a molecular weight of 260.69 g/mol, XLogP of 0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-3-oxobutanoate;methanesulfonic acid is sourced from PubChem (CID 172837114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).