C18H36N2O4 — CID 158012877
3-[di(propan-2-yl)amino]-3-oxopropanoic acid;N,N-di(propan-2-yl)propanamide (PubChem CID 158012877) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-[di(propan-2-yl)amino]-3-oxopropanoic acid;N,N-di(propan-2-yl)propanamide.
| Compound Name | 3-[di(propan-2-yl)amino]-3-oxopropanoic acid;N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 158012877 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 3-[di(propan-2-yl)amino]-3-oxopropanoic acid;N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)CC(=O)O)C(C)C.CCC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H17NO3.C9H19NO/c1-6(2)10(7(3)4)8(11)5-9(12)13;1-6-9(11)10(7(2)3)8(4)5/h6-7H,5H2,1-4H3,(H,12,13);7-8H,6H2,1-5H3 |
| InChIKey | FFCMARCKOVCXTG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|