C10H22N2O2 — CID 110878963
3-(1-hydroxybutan-2-ylamino)-N,N-dimethylbutanamide (PubChem CID 110878963) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(1-hydroxybutan-2-ylamino)-N,N-dimethylbutanamide.
| Compound Name | 3-(1-hydroxybutan-2-ylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 110878963 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-(1-hydroxybutan-2-ylamino)-N,N-dimethylbutanamide |
| SMILES | CCC(CO)NC(C)CC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-5-9(7-13)11-8(2)6-10(14)12(3)4/h8-9,11,13H,5-7H2,1-4H3 |
| InChIKey | JLKIVNAJIPDIRA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |