C10H21NO3 — CID 61425240
2-[2-hydroxyethyl(propyl)amino]-3-methylbutanoic acid (PubChem CID 61425240) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(propyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[2-hydroxyethyl(propyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61425240 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-[2-hydroxyethyl(propyl)amino]-3-methylbutanoic acid |
| SMILES | CCCN(CCO)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H21NO3/c1-4-5-11(6-7-12)9(8(2)3)10(13)14/h8-9,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | CPBUCQHANNWCCM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |