C19H34N4O6 — CID 58262384
CID 58262384 (PubChem CID 58262384) has the molecular formula C19H34N4O6 and a molecular weight of 414.50 g/mol.
| Compound Name | CID 58262384 |
|---|---|
| PubChem CID | 58262384 |
| Molecular Formula | C19H34N4O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | — |
| SMILES | [CH]N([CH])CCN(CCN(CC(=O)O)CC(=O)O)C(CCCCNC(C)C)C(=O)O |
| InChI | InChI=1S/C19H34N4O6/c1-15(2)20-8-6-5-7-16(19(28)29)23(11-9-21(3)4)12-10-22(13-17(24)25)14-18(26)27/h3-4,15-16,20H,5-14H2,1-2H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | UPLLDWKHAPKHCH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|