C13H22N3O7P — CID 58262345
CID 58262345 (PubChem CID 58262345) has the molecular formula C13H22N3O7P and a molecular weight of 363.31 g/mol.
| Compound Name | CID 58262345 |
|---|---|
| PubChem CID | 58262345 |
| Molecular Formula | C13H22N3O7P |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | — |
| SMILES | [CH]CC(N(CCN([CH])[CH])CCN(CC(=O)O)CC(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H22N3O7P/c1-4-11(24(21,22)23)16(7-5-14(2)3)8-6-15(9-12(17)18)10-13(19)20/h1-3,11H,4-10H2,(H,17,18)(H,19,20)(H2,21,22,23) |
| InChIKey | IXDKHZIHRCIVGH-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|