C21H39BN4O8 — CID 174027742
CID 174027742 (PubChem CID 174027742) has the molecular formula C21H39BN4O8 and a molecular weight of 486.38 g/mol.
| Compound Name | CID 174027742 |
|---|---|
| PubChem CID | 174027742 |
| Molecular Formula | C21H39BN4O8 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | — |
| SMILES | [B]CCOCCNC(=O)CCC(C(=O)O)N(CCN(CC)CC(=O)O)CCN(CC)CC(=O)O |
| InChI | InChI=1S/C21H39BN4O8/c1-3-24(15-19(28)29)9-11-26(12-10-25(4-2)16-20(30)31)17(21(32)33)5-6-18(27)23-8-14-34-13-7-22/h17H,3-16H2,1-2H3,(H,23,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | QREJWUHFEZJQKM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|