C34H65BN4O13 — CID 168960736
CID 168960736 (PubChem CID 168960736) has the molecular formula C34H65BN4O13 and a molecular weight of 748.72 g/mol.
| Compound Name | CID 168960736 |
|---|---|
| PubChem CID | 168960736 |
| Molecular Formula | C34H65BN4O13 |
| Molecular Weight | 748.72 g/mol |
| Exact Mass | 748.46 |
| IUPAC Name | — |
| SMILES | CCC(O)O.[B]C(=O)CCOCCOCCOCCNC(=O)CCC(C(=O)O)N(CCC)CCN(CCN(CCC(C)CC)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C31H57BN4O11.C3H8O2/c1-4-11-36(16-15-35(24-30(41)42)14-13-34(23-29(39)40)12-8-25(3)5-2)26(31(43)44)6-7-28(38)33-10-18-46-20-22-47-21-19-45-17-9-27(32)37;1-2-3(4)5/h25-26H,4-24H2,1-3H3,(H,33,38)(H,39,40)(H,41,42)(H,43,44);3-5H,2H2,1H3 |
| InChIKey | HPCLNBULPVADLY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.72 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|