C15H26N4O8 — CID 175480965
2-[(2-amino-4-carboxybutanoyl)-(2,6-diaminohexanoyl)amino]butanedioic acid (PubChem CID 175480965) has the molecular formula C15H26N4O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[(2-amino-4-carboxybutanoyl)-(2,6-diaminohexanoyl)amino]butanedioic acid.
| Compound Name | 2-[(2-amino-4-carboxybutanoyl)-(2,6-diaminohexanoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 175480965 |
| Molecular Formula | C15H26N4O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[(2-amino-4-carboxybutanoyl)-(2,6-diaminohexanoyl)amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)N(C(=O)C(N)CCC(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N4O8/c16-6-2-1-3-8(17)13(24)19(10(15(26)27)7-12(22)23)14(25)9(18)4-5-11(20)21/h8-10H,1-7,16-18H2,(H,20,21)(H,22,23)(H,26,27) |
| InChIKey | VOXFBTKOQIDUEB-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 227.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|