C15H29N5O5 — CID 175092874
4-amino-2-[(2-amino-3-methylbutanoyl)-(2,6-diaminohexanoyl)amino]-4-oxobutanoic acid (PubChem CID 175092874) has the molecular formula C15H29N5O5 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-amino-2-[(2-amino-3-methylbutanoyl)-(2,6-diaminohexanoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(2-amino-3-methylbutanoyl)-(2,6-diaminohexanoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175092874 |
| Molecular Formula | C15H29N5O5 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-amino-2-[(2-amino-3-methylbutanoyl)-(2,6-diaminohexanoyl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(N)C(=O)N(C(=O)C(N)CCCCN)C(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H29N5O5/c1-8(2)12(19)14(23)20(10(15(24)25)7-11(18)21)13(22)9(17)5-3-4-6-16/h8-10,12H,3-7,16-17,19H2,1-2H3,(H2,18,21)(H,24,25) |
| InChIKey | CEVCCCCHDUNOPI-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 195.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|