C23H49N11O7 — CID 89332666
2-[[(2S)-6-amino-2-[bis[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 89332666) has the molecular formula C23H49N11O7 and a molecular weight of 591.72 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[bis[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(2S)-6-amino-2-[bis[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 89332666 |
| Molecular Formula | C23H49N11O7 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[bis[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | NCCCC[C@@H](C(=O)NC(CCC(=O)O)C(=O)O)N(C(=O)[C@@H](N)CCCNC(N)N)C(=O)[C@@H](N)CCCNC(N)N |
| InChI | InChI=1S/C23H49N11O7/c24-10-2-1-7-16(18(37)33-15(21(40)41)8-9-17(35)36)34(19(38)13(25)5-3-11-31-22(27)28)20(39)14(26)6-4-12-32-23(29)30/h13-16,22-23,31-32H,1-12,24-30H2,(H,33,37)(H,35,36)(H,40,41)/t13-,14-,15?,16-/m0/s1 |
| InChIKey | IPNHPPJIAWCIIM-OJTCVJSUSA-N |
| XLogP | -4.93 |
| TPSA | 347.28 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|