C11H16N2O8 — CID 11989787
2-[acetyl-(2-amino-3-carboxypropanoyl)amino]pentanedioic acid (PubChem CID 11989787) has the molecular formula C11H16N2O8 and a molecular weight of 304.26 g/mol. Its IUPAC name is 2-[acetyl-(2-amino-3-carboxypropanoyl)amino]pentanedioic acid.
| Compound Name | 2-[acetyl-(2-amino-3-carboxypropanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 11989787 |
| Molecular Formula | C11H16N2O8 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[acetyl-(2-amino-3-carboxypropanoyl)amino]pentanedioic acid |
| SMILES | CC(=O)N(C(=O)C(N)CC(=O)O)C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N2O8/c1-5(14)13(10(19)6(12)4-9(17)18)7(11(20)21)2-3-8(15)16/h6-7H,2-4,12H2,1H3,(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | UBNVHOHEXYIHKG-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |