C13H22N2O7S — CID 175964949
(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid (PubChem CID 175964949) has the molecular formula C13H22N2O7S and a molecular weight of 350.39 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175964949 |
| Molecular Formula | C13H22N2O7S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)[C@@H](N)CS)[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H22N2O7S/c1-13(2,3)22-12(21)15(10(18)7(14)6-23)8(11(19)20)4-5-9(16)17/h7-8,23H,4-6,14H2,1-3H3,(H,16,17)(H,19,20)/t7-,8-/m0/s1 |
| InChIKey | JABCVFKFLUSVHA-YUMQZZPRSA-N |
| XLogP | 0.33 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|