C9H17NO4SSe — CID 87596753
(2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-methylselanylamino]-3-sulfanylpropanoic acid (PubChem CID 87596753) has the molecular formula C9H17NO4SSe and a molecular weight of 314.27 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-methylselanylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-methylselanylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87596753 |
| Molecular Formula | C9H17NO4SSe |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-methylselanylamino]-3-sulfanylpropanoic acid |
| SMILES | C[Se]N(C(=O)OC(C)(C)C)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C9H17NO4SSe/c1-9(2,3)14-8(13)10(16-4)6(5-15)7(11)12/h6,15H,5H2,1-4H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | ZUITZGWXSGCDGO-LURJTMIESA-N |
| XLogP | 1.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|