C11H21NO4S2 — CID 88817374
(2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylsulfanylamino]-3-sulfanylpropanoic acid (PubChem CID 88817374) has the molecular formula C11H21NO4S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylsulfanylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylsulfanylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88817374 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylsulfanylamino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)SN(C(=O)OC(C)(C)C)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C11H21NO4S2/c1-7(2)18-12(8(6-17)9(13)14)10(15)16-11(3,4)5/h7-8,17H,6H2,1-5H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | WJYUUKYQTKMWSH-QMMMGPOBSA-N |
| XLogP | 2.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|