C21H25NO4S — CID 87312522
(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-phenylphenyl)methyl]amino]-3-sulfanylpropanoic acid (PubChem CID 87312522) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-phenylphenyl)methyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-phenylphenyl)methyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87312522 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-phenylphenyl)methyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1-c1ccccc1)[C@H](CS)C(=O)O |
| InChI | InChI=1S/C21H25NO4S/c1-21(2,3)26-20(25)22(18(14-27)19(23)24)13-16-11-7-8-12-17(16)15-9-5-4-6-10-15/h4-12,18,27H,13-14H2,1-3H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | ZOPOTOVGNHODPA-GOSISDBHSA-N |
| XLogP | 4.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|