C33H45NO7 — CID 123732204
(2S)-2-[[3-(10-ethoxy-2,9-dioxodecyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid (PubChem CID 123732204) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is (2S)-2-[[3-(10-ethoxy-2,9-dioxodecyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[3-(10-ethoxy-2,9-dioxodecyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 123732204 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | (2S)-2-[[3-(10-ethoxy-2,9-dioxodecyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid |
| SMILES | CCOCC(=O)CCCCCCC(=O)Cc1cccc(CN(C(=O)OC(C)(C)C)[C@@H](Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C33H45NO7/c1-5-40-24-29(36)19-12-7-6-11-18-28(35)21-26-16-13-17-27(20-26)23-34(32(39)41-33(2,3)4)30(31(37)38)22-25-14-9-8-10-15-25/h8-10,13-17,20,30H,5-7,11-12,18-19,21-24H2,1-4H3,(H,37,38)/t30-/m0/s1 |
| InChIKey | JPKFXWABDHVATD-PMERELPUSA-N |
| XLogP | 6.18 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|