C18H29N3O4 — CID 175077000
(2S)-2-[1,4-diaminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid (PubChem CID 175077000) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[1,4-diaminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[1,4-diaminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 175077000 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2S)-2-[1,4-diaminobutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(N)CCCN)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H29N3O4/c1-18(2,3)25-17(24)21(15(20)10-7-11-19)14(16(22)23)12-13-8-5-4-6-9-13/h4-6,8-9,14-15H,7,10-12,19-20H2,1-3H3,(H,22,23)/t14-,15?/m0/s1 |
| InChIKey | XGXCCKRSFDTGPV-MLCCFXAWSA-N |
| XLogP | 1.94 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|