C18H26N2O5 — CID 174370152
2-[amino-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 174370152) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[amino-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[amino-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174370152 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[amino-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)C(C)(C)C(=O)N(N)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H26N2O5/c1-17(2,3)25-16(24)18(4,5)15(23)20(19)13(14(21)22)11-12-9-7-6-8-10-12/h6-10,13H,11,19H2,1-5H3,(H,21,22) |
| InChIKey | PMNROEVUJOFCJF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|