C21H22F3NO3 — CID 146167455
tert-butyl (2S)-2-[benzoyl(trifluoromethyl)amino]-3-phenylpropanoate (PubChem CID 146167455) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-[benzoyl(trifluoromethyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[benzoyl(trifluoromethyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 146167455 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | tert-butyl (2S)-2-[benzoyl(trifluoromethyl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)N(C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO3/c1-20(2,3)28-19(27)17(14-15-10-6-4-7-11-15)25(21(22,23)24)18(26)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | BLQKVSCAGQQODI-KRWDZBQOSA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|