C15H17F4NO3 — CID 146167361
tert-butyl (2S)-2-[carbonofluoridoyl(trifluoromethyl)amino]-3-phenylpropanoate (PubChem CID 146167361) has the molecular formula C15H17F4NO3 and a molecular weight of 335.30 g/mol. Its IUPAC name is tert-butyl (2S)-2-[carbonofluoridoyl(trifluoromethyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[carbonofluoridoyl(trifluoromethyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 146167361 |
| Molecular Formula | C15H17F4NO3 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | tert-butyl (2S)-2-[carbonofluoridoyl(trifluoromethyl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)N(C(=O)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F4NO3/c1-14(2,3)23-12(21)11(9-10-7-5-4-6-8-10)20(13(16)22)15(17,18)19/h4-8,11H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | WGKPEBCQNMPCOZ-NSHDSACASA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|