C22H35NO10 — CID 25194368
(2R)-2-[(E,5S)-5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxy-6-oxohex-1-enyl]pentanedioic acid (PubChem CID 25194368) has the molecular formula C22H35NO10 and a molecular weight of 473.52 g/mol. Its IUPAC name is (2R)-2-[(E,5S)-5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxy-6-oxohex-1-enyl]pentanedioic acid.
| Compound Name | (2R)-2-[(E,5S)-5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxy-6-oxohex-1-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 25194368 |
| Molecular Formula | C22H35NO10 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2R)-2-[(E,5S)-5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxy-6-oxohex-1-enyl]pentanedioic acid |
| SMILES | COC(=O)[C@H](CC/C=C/[C@@H](CCC(=O)O)C(=O)O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35NO10/c1-21(2,3)32-19(29)23(20(30)33-22(4,5)6)15(18(28)31-7)11-9-8-10-14(17(26)27)12-13-16(24)25/h8,10,14-15H,9,11-13H2,1-7H3,(H,24,25)(H,26,27)/b10-8+/t14-,15-/m0/s1 |
| InChIKey | IPROJVBBNNUYEO-VFDMCBIDSA-N |
| XLogP | 3.60 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|