C20H34FN3O6 — CID 91226011
methyl (2S)-7-(1-aminoethylideneamino)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-fluorohept-5-enoate (PubChem CID 91226011) has the molecular formula C20H34FN3O6 and a molecular weight of 431.51 g/mol. Its IUPAC name is methyl (2S)-7-(1-aminoethylideneamino)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-fluorohept-5-enoate.
| Compound Name | methyl (2S)-7-(1-aminoethylideneamino)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-fluorohept-5-enoate |
|---|---|
| PubChem CID | 91226011 |
| Molecular Formula | C20H34FN3O6 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | methyl (2S)-7-(1-aminoethylideneamino)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-fluorohept-5-enoate |
| SMILES | COC(=O)[C@H](CCC=C(F)C/N=C(\C)N)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34FN3O6/c1-13(22)23-12-14(21)10-9-11-15(16(25)28-8)24(17(26)29-19(2,3)4)18(27)30-20(5,6)7/h10,15H,9,11-12H2,1-8H3,(H2,22,23)/t15-/m0/s1 |
| InChIKey | VXJVATKAZMURGH-HNNXBMFYSA-N |
| XLogP | 3.71 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|